C6H8FN3 — CID 84648615
5-fluoro-2-N-methylpyridine-2,3-diamine (PubChem CID 84648615) has the molecular formula C6H8FN3 and a molecular weight of 141.15 g/mol. Its IUPAC name is 5-fluoro-2-N-methylpyridine-2,3-diamine.
| Compound Name | 5-fluoro-2-N-methylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 84648615 |
| Molecular Formula | C6H8FN3 |
| Molecular Weight | 141.15 g/mol |
| Exact Mass | 141.07 |
| IUPAC Name | 5-fluoro-2-N-methylpyridine-2,3-diamine |
| SMILES | CNc1ncc(F)cc1N |
| InChI | InChI=1S/C6H8FN3/c1-9-6-5(8)2-4(7)3-10-6/h2-3H,8H2,1H3,(H,9,10) |
| InChIKey | KFYCNURIPTWFQK-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |