About 3-(4,5-dihydro-1,3-oxazol-2-yl)propanoic acid
3-(4,5-dihydro-1,3-oxazol-2-yl)propanoic acid (PubChem CID 84648829) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is 3-(4,5-dihydro-1,3-oxazol-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(4,5-dihydro-1,3-oxazol-2-yl)propanoic acid |
| PubChem CID | 84648829 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 3-(4,5-dihydro-1,3-oxazol-2-yl)propanoic acid |
| SMILES | O=C(O)CCC1=NCCO1 |
| InChI | InChI=1S/C6H9NO3/c8-6(9)2-1-5-7-3-4-10-5/h1-4H2,(H,8,9) |
| InChIKey | RCUKTMOISQQFBQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4,5-dihydro-1,3-oxazol-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dihydro-1,3-oxazol-2-yl)propanoic acid?
The IUPAC name of 3-(4,5-dihydro-1,3-oxazol-2-yl)propanoic acid (CID 84648829) is 3-(4,5-dihydro-1,3-oxazol-2-yl)propanoic acid.
What is the SMILES notation for 3-(4,5-dihydro-1,3-oxazol-2-yl)propanoic acid?
The canonical SMILES for 3-(4,5-dihydro-1,3-oxazol-2-yl)propanoic acid is O=C(O)CCC1=NCCO1.
What is the InChIKey of 3-(4,5-dihydro-1,3-oxazol-2-yl)propanoic acid?
The InChIKey is RCUKTMOISQQFBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c8-6(9)2-1-5-7-3-4-10-5/h1-4H2,(H,8,9).
What are the key properties of 3-(4,5-dihydro-1,3-oxazol-2-yl)propanoic acid?
3-(4,5-dihydro-1,3-oxazol-2-yl)propanoic acid has a molecular weight of 143.14 g/mol, XLogP of 0.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dihydro-1,3-oxazol-2-yl)propanoic acid is sourced from PubChem (CID 84648829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).