C5H9FN4 — CID 84648940
2-fluoro-3-(1,2,4-triazol-1-yl)propan-1-amine (PubChem CID 84648940) has the molecular formula C5H9FN4 and a molecular weight of 144.15 g/mol. Its IUPAC name is 2-fluoro-3-(1,2,4-triazol-1-yl)propan-1-amine.
| Compound Name | 2-fluoro-3-(1,2,4-triazol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 84648940 |
| Molecular Formula | C5H9FN4 |
| Molecular Weight | 144.15 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | 2-fluoro-3-(1,2,4-triazol-1-yl)propan-1-amine |
| SMILES | NCC(F)Cn1cncn1 |
| InChI | InChI=1S/C5H9FN4/c6-5(1-7)2-10-4-8-3-9-10/h3-5H,1-2,7H2 |
| InChIKey | YPWNLJVVGRYTLB-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.15 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |