C7H3N3O — CID 84649010
2-oxo-1H-pyridine-3,5-dicarbonitrile (PubChem CID 84649010) has the molecular formula C7H3N3O and a molecular weight of 145.12 g/mol. Its IUPAC name is 2-oxo-1H-pyridine-3,5-dicarbonitrile.
| Compound Name | 2-oxo-1H-pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 84649010 |
| Molecular Formula | C7H3N3O |
| Molecular Weight | 145.12 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | 2-oxo-1H-pyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c[nH]c(=O)c(C#N)c1 |
| InChI | InChI=1S/C7H3N3O/c8-2-5-1-6(3-9)7(11)10-4-5/h1,4H,(H,10,11) |
| InChIKey | LZPXQUNVCYRSCS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.12 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |