About 3-methyltriazolo[4,5-b]pyridin-6-amine
3-methyltriazolo[4,5-b]pyridin-6-amine (PubChem CID 84649283) has the molecular formula C6H7N5
and a molecular weight of 149.16 g/mol. Its IUPAC name is 3-methyltriazolo[4,5-b]pyridin-6-amine.
Molecular Properties
| Compound Name | 3-methyltriazolo[4,5-b]pyridin-6-amine |
| PubChem CID | 84649283 |
| Molecular Formula | C6H7N5 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 3-methyltriazolo[4,5-b]pyridin-6-amine |
| SMILES | Cn1nnc2cc(N)cnc21 |
| InChI | InChI=1S/C6H7N5/c1-11-6-5(9-10-11)2-4(7)3-8-6/h2-3H,7H2,1H3 |
| InChIKey | GCOMIZMNQUDDCQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methyltriazolo[4,5-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyltriazolo[4,5-b]pyridin-6-amine?
The IUPAC name of 3-methyltriazolo[4,5-b]pyridin-6-amine (CID 84649283) is 3-methyltriazolo[4,5-b]pyridin-6-amine.
What is the SMILES notation for 3-methyltriazolo[4,5-b]pyridin-6-amine?
The canonical SMILES for 3-methyltriazolo[4,5-b]pyridin-6-amine is Cn1nnc2cc(N)cnc21.
What is the InChIKey of 3-methyltriazolo[4,5-b]pyridin-6-amine?
The InChIKey is GCOMIZMNQUDDCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5/c1-11-6-5(9-10-11)2-4(7)3-8-6/h2-3H,7H2,1H3.
What are the key properties of 3-methyltriazolo[4,5-b]pyridin-6-amine?
3-methyltriazolo[4,5-b]pyridin-6-amine has a molecular weight of 149.16 g/mol, XLogP of -0.05, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyltriazolo[4,5-b]pyridin-6-amine is sourced from PubChem (CID 84649283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).