About 2-azaspiro[4.4]nonane-1,9-dione
2-azaspiro[4.4]nonane-1,9-dione (PubChem CID 84649737) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 2-azaspiro[4.4]nonane-1,9-dione.
Molecular Properties
| Compound Name | 2-azaspiro[4.4]nonane-1,9-dione |
| PubChem CID | 84649737 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 2-azaspiro[4.4]nonane-1,9-dione |
| SMILES | O=C1CCCC12CCNC2=O |
| InChI | InChI=1S/C8H11NO2/c10-6-2-1-3-8(6)4-5-9-7(8)11/h1-5H2,(H,9,11) |
| InChIKey | GESBMLLPMMYSGS-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-azaspiro[4.4]nonane-1,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaspiro[4.4]nonane-1,9-dione?
The IUPAC name of 2-azaspiro[4.4]nonane-1,9-dione (CID 84649737) is 2-azaspiro[4.4]nonane-1,9-dione.
What is the SMILES notation for 2-azaspiro[4.4]nonane-1,9-dione?
The canonical SMILES for 2-azaspiro[4.4]nonane-1,9-dione is O=C1CCCC12CCNC2=O.
What is the InChIKey of 2-azaspiro[4.4]nonane-1,9-dione?
The InChIKey is GESBMLLPMMYSGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c10-6-2-1-3-8(6)4-5-9-7(8)11/h1-5H2,(H,9,11).
What are the key properties of 2-azaspiro[4.4]nonane-1,9-dione?
2-azaspiro[4.4]nonane-1,9-dione has a molecular weight of 153.18 g/mol, XLogP of 0.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaspiro[4.4]nonane-1,9-dione is sourced from PubChem (CID 84649737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).