About 2-amino-1-(1,5-dimethylimidazol-4-yl)ethanone
2-amino-1-(1,5-dimethylimidazol-4-yl)ethanone (PubChem CID 84649782) has the molecular formula C7H11N3O
and a molecular weight of 153.18 g/mol. Its IUPAC name is 2-amino-1-(1,5-dimethylimidazol-4-yl)ethanone.
Molecular Properties
| Compound Name | 2-amino-1-(1,5-dimethylimidazol-4-yl)ethanone |
| PubChem CID | 84649782 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 2-amino-1-(1,5-dimethylimidazol-4-yl)ethanone |
| SMILES | Cc1c(C(=O)CN)ncn1C |
| InChI | InChI=1S/C7H11N3O/c1-5-7(6(11)3-8)9-4-10(5)2/h4H,3,8H2,1-2H3 |
| InChIKey | JZTBHBWDEWQPTB-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-(1,5-dimethylimidazol-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(1,5-dimethylimidazol-4-yl)ethanone?
The IUPAC name of 2-amino-1-(1,5-dimethylimidazol-4-yl)ethanone (CID 84649782) is 2-amino-1-(1,5-dimethylimidazol-4-yl)ethanone.
What is the SMILES notation for 2-amino-1-(1,5-dimethylimidazol-4-yl)ethanone?
The canonical SMILES for 2-amino-1-(1,5-dimethylimidazol-4-yl)ethanone is Cc1c(C(=O)CN)ncn1C.
What is the InChIKey of 2-amino-1-(1,5-dimethylimidazol-4-yl)ethanone?
The InChIKey is JZTBHBWDEWQPTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O/c1-5-7(6(11)3-8)9-4-10(5)2/h4H,3,8H2,1-2H3.
What are the key properties of 2-amino-1-(1,5-dimethylimidazol-4-yl)ethanone?
2-amino-1-(1,5-dimethylimidazol-4-yl)ethanone has a molecular weight of 153.18 g/mol, XLogP of -0.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(1,5-dimethylimidazol-4-yl)ethanone is sourced from PubChem (CID 84649782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).