About 4-methyl-4,8-diazaspiro[2.6]nonan-5-one
4-methyl-4,8-diazaspiro[2.6]nonan-5-one (PubChem CID 84649985) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 4-methyl-4,8-diazaspiro[2.6]nonan-5-one.
Molecular Properties
| Compound Name | 4-methyl-4,8-diazaspiro[2.6]nonan-5-one |
| PubChem CID | 84649985 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 4-methyl-4,8-diazaspiro[2.6]nonan-5-one |
| SMILES | CN1C(=O)CCNCC12CC2 |
| InChI | InChI=1S/C8H14N2O/c1-10-7(11)2-5-9-6-8(10)3-4-8/h9H,2-6H2,1H3 |
| InChIKey | UTHJUZIEEXXJAP-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-4,8-diazaspiro[2.6]nonan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4,8-diazaspiro[2.6]nonan-5-one?
The IUPAC name of 4-methyl-4,8-diazaspiro[2.6]nonan-5-one (CID 84649985) is 4-methyl-4,8-diazaspiro[2.6]nonan-5-one.
What is the SMILES notation for 4-methyl-4,8-diazaspiro[2.6]nonan-5-one?
The canonical SMILES for 4-methyl-4,8-diazaspiro[2.6]nonan-5-one is CN1C(=O)CCNCC12CC2.
What is the InChIKey of 4-methyl-4,8-diazaspiro[2.6]nonan-5-one?
The InChIKey is UTHJUZIEEXXJAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-10-7(11)2-5-9-6-8(10)3-4-8/h9H,2-6H2,1H3.
What are the key properties of 4-methyl-4,8-diazaspiro[2.6]nonan-5-one?
4-methyl-4,8-diazaspiro[2.6]nonan-5-one has a molecular weight of 154.21 g/mol, XLogP of -0.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4,8-diazaspiro[2.6]nonan-5-one is sourced from PubChem (CID 84649985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).