C7H13N3O — CID 84650199
1,2,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazin-3-one (PubChem CID 84650199) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 1,2,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazin-3-one.
| Compound Name | 1,2,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazin-3-one |
|---|---|
| PubChem CID | 84650199 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 1,2,4,6,7,8,9,9a-octahydropyrazino[1,2-a]pyrazin-3-one |
| SMILES | O=C1CN2CCNCC2CN1 |
| InChI | InChI=1S/C7H13N3O/c11-7-5-10-2-1-8-3-6(10)4-9-7/h6,8H,1-5H2,(H,9,11) |
| InChIKey | QZODPNKKZOTCTI-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |