C7H6F2N2 — CID 84650304
1-(2,2-difluoroethyl)pyrrole-2-carbonitrile (PubChem CID 84650304) has the molecular formula C7H6F2N2 and a molecular weight of 156.13 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)pyrrole-2-carbonitrile.
| Compound Name | 1-(2,2-difluoroethyl)pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 84650304 |
| Molecular Formula | C7H6F2N2 |
| Molecular Weight | 156.13 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 1-(2,2-difluoroethyl)pyrrole-2-carbonitrile |
| SMILES | N#Cc1cccn1CC(F)F |
| InChI | InChI=1S/C7H6F2N2/c8-7(9)5-11-3-1-2-6(11)4-10/h1-3,7H,5H2 |
| InChIKey | KERSFLQRGPJUPW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.13 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |