4-oxo-1-propan-2-ylazetidine-2-carboxylic acid

C7H11NO3 — CID 84650541

IUPAC4-oxo-1-propan-2-ylazetidine-2-carboxylic acid
SMILESCC(C)N1C(=O)CC1C(=O)O
InChIInChI=1S/C7H11NO3/c1-4(2)8-5(7(10)11)3-6(8)9/h4-5H,3H2,1-2H3,(H,10,11)
InChIKeyYHVJLUKLPQLMRK-UHFFFAOYSA-N
MW157.17 g/mol
LogP0.08
Rot. Bonds2

About 4-oxo-1-propan-2-ylazetidine-2-carboxylic acid

4-oxo-1-propan-2-ylazetidine-2-carboxylic acid (PubChem CID 84650541) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is 4-oxo-1-propan-2-ylazetidine-2-carboxylic acid.

Molecular Properties

Compound Name4-oxo-1-propan-2-ylazetidine-2-carboxylic acid
PubChem CID84650541
Molecular FormulaC7H11NO3
Molecular Weight157.17 g/mol
Exact Mass157.07
IUPAC Name4-oxo-1-propan-2-ylazetidine-2-carboxylic acid
SMILESCC(C)N1C(=O)CC1C(=O)O
InChIInChI=1S/C7H11NO3/c1-4(2)8-5(7(10)11)3-6(8)9/h4-5H,3H2,1-2H3,(H,10,11)
InChIKeyYHVJLUKLPQLMRK-UHFFFAOYSA-N
XLogP0.08
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500157.17
LogP ≤ 50.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-oxo-1-propan-2-ylazetidine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-1-propan-2-ylazetidine-2-carboxylic acid?
The IUPAC name of 4-oxo-1-propan-2-ylazetidine-2-carboxylic acid (CID 84650541) is 4-oxo-1-propan-2-ylazetidine-2-carboxylic acid.
What is the SMILES notation for 4-oxo-1-propan-2-ylazetidine-2-carboxylic acid?
The canonical SMILES for 4-oxo-1-propan-2-ylazetidine-2-carboxylic acid is CC(C)N1C(=O)CC1C(=O)O.
What is the InChIKey of 4-oxo-1-propan-2-ylazetidine-2-carboxylic acid?
The InChIKey is YHVJLUKLPQLMRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-4(2)8-5(7(10)11)3-6(8)9/h4-5H,3H2,1-2H3,(H,10,11).
What are the key properties of 4-oxo-1-propan-2-ylazetidine-2-carboxylic acid?
4-oxo-1-propan-2-ylazetidine-2-carboxylic acid has a molecular weight of 157.17 g/mol, XLogP of 0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-1-propan-2-ylazetidine-2-carboxylic acid is sourced from PubChem (CID 84650541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).