About 2-methoxypyridine-3,5-dicarbonitrile
2-methoxypyridine-3,5-dicarbonitrile (PubChem CID 84650868) has the molecular formula C8H5N3O
and a molecular weight of 159.15 g/mol. Its IUPAC name is 2-methoxypyridine-3,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-methoxypyridine-3,5-dicarbonitrile |
| PubChem CID | 84650868 |
| Molecular Formula | C8H5N3O |
| Molecular Weight | 159.15 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 2-methoxypyridine-3,5-dicarbonitrile |
| SMILES | COc1ncc(C#N)cc1C#N |
| InChI | InChI=1S/C8H5N3O/c1-12-8-7(4-10)2-6(3-9)5-11-8/h2,5H,1H3 |
| InChIKey | BTIYFDARJSXLRD-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.15 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxypyridine-3,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxypyridine-3,5-dicarbonitrile?
The IUPAC name of 2-methoxypyridine-3,5-dicarbonitrile (CID 84650868) is 2-methoxypyridine-3,5-dicarbonitrile.
What is the SMILES notation for 2-methoxypyridine-3,5-dicarbonitrile?
The canonical SMILES for 2-methoxypyridine-3,5-dicarbonitrile is COc1ncc(C#N)cc1C#N.
What is the InChIKey of 2-methoxypyridine-3,5-dicarbonitrile?
The InChIKey is BTIYFDARJSXLRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O/c1-12-8-7(4-10)2-6(3-9)5-11-8/h2,5H,1H3.
What are the key properties of 2-methoxypyridine-3,5-dicarbonitrile?
2-methoxypyridine-3,5-dicarbonitrile has a molecular weight of 159.15 g/mol, XLogP of 0.83, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypyridine-3,5-dicarbonitrile is sourced from PubChem (CID 84650868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).