C6H9F2N3 — CID 84651171
1-(3,3-difluoropropyl)-3-methyl-1,2,4-triazole (PubChem CID 84651171) has the molecular formula C6H9F2N3 and a molecular weight of 161.16 g/mol. Its IUPAC name is 1-(3,3-difluoropropyl)-3-methyl-1,2,4-triazole.
| Compound Name | 1-(3,3-difluoropropyl)-3-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 84651171 |
| Molecular Formula | C6H9F2N3 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 1-(3,3-difluoropropyl)-3-methyl-1,2,4-triazole |
| SMILES | Cc1ncn(CCC(F)F)n1 |
| InChI | InChI=1S/C6H9F2N3/c1-5-9-4-11(10-5)3-2-6(7)8/h4,6H,2-3H2,1H3 |
| InChIKey | RCZJPGWHEGBMQK-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |