About 4-oxo-3,5-dihydro-2H-furo[3,2-c]pyridine-7-carbonitrile
4-oxo-3,5-dihydro-2H-furo[3,2-c]pyridine-7-carbonitrile (PubChem CID 84651328) has the molecular formula C8H6N2O2
and a molecular weight of 162.15 g/mol. Its IUPAC name is 4-oxo-3,5-dihydro-2H-furo[3,2-c]pyridine-7-carbonitrile.
Molecular Properties
| Compound Name | 4-oxo-3,5-dihydro-2H-furo[3,2-c]pyridine-7-carbonitrile |
| PubChem CID | 84651328 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.15 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | 4-oxo-3,5-dihydro-2H-furo[3,2-c]pyridine-7-carbonitrile |
| SMILES | N#Cc1c[nH]c(=O)c2c1OCC2 |
| InChI | InChI=1S/C8H6N2O2/c9-3-5-4-10-8(11)6-1-2-12-7(5)6/h4H,1-2H2,(H,10,11) |
| InChIKey | NLRYUTRYXDWCKD-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.15 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-oxo-3,5-dihydro-2H-furo[3,2-c]pyridine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-3,5-dihydro-2H-furo[3,2-c]pyridine-7-carbonitrile?
The IUPAC name of 4-oxo-3,5-dihydro-2H-furo[3,2-c]pyridine-7-carbonitrile (CID 84651328) is 4-oxo-3,5-dihydro-2H-furo[3,2-c]pyridine-7-carbonitrile.
What is the SMILES notation for 4-oxo-3,5-dihydro-2H-furo[3,2-c]pyridine-7-carbonitrile?
The canonical SMILES for 4-oxo-3,5-dihydro-2H-furo[3,2-c]pyridine-7-carbonitrile is N#Cc1c[nH]c(=O)c2c1OCC2.
What is the InChIKey of 4-oxo-3,5-dihydro-2H-furo[3,2-c]pyridine-7-carbonitrile?
The InChIKey is NLRYUTRYXDWCKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2/c9-3-5-4-10-8(11)6-1-2-12-7(5)6/h4H,1-2H2,(H,10,11).
What are the key properties of 4-oxo-3,5-dihydro-2H-furo[3,2-c]pyridine-7-carbonitrile?
4-oxo-3,5-dihydro-2H-furo[3,2-c]pyridine-7-carbonitrile has a molecular weight of 162.15 g/mol, XLogP of 0.18, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3,5-dihydro-2H-furo[3,2-c]pyridine-7-carbonitrile is sourced from PubChem (CID 84651328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).