About 6-amino-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbaldehyde
6-amino-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbaldehyde (PubChem CID 84651506) has the molecular formula C6H5N5O
and a molecular weight of 163.14 g/mol. Its IUPAC name is 6-amino-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbaldehyde.
Molecular Properties
| Compound Name | 6-amino-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbaldehyde |
| PubChem CID | 84651506 |
| Molecular Formula | C6H5N5O |
| Molecular Weight | 163.14 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | 6-amino-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbaldehyde |
| SMILES | Nc1cnc2nc(C=O)nn2c1 |
| InChI | InChI=1S/C6H5N5O/c7-4-1-8-6-9-5(3-12)10-11(6)2-4/h1-3H,7H2 |
| InChIKey | NTOLNNGHVPECKB-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.14 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbaldehyde?
The IUPAC name of 6-amino-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbaldehyde (CID 84651506) is 6-amino-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbaldehyde.
What is the SMILES notation for 6-amino-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbaldehyde?
The canonical SMILES for 6-amino-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbaldehyde is Nc1cnc2nc(C=O)nn2c1.
What is the InChIKey of 6-amino-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbaldehyde?
The InChIKey is NTOLNNGHVPECKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N5O/c7-4-1-8-6-9-5(3-12)10-11(6)2-4/h1-3H,7H2.
What are the key properties of 6-amino-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbaldehyde?
6-amino-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbaldehyde has a molecular weight of 163.14 g/mol, XLogP of -0.48, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-[1,2,4]triazolo[1,5-a]pyrimidine-2-carbaldehyde is sourced from PubChem (CID 84651506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).