C5H3F2NOS — CID 84651507
5-(difluoromethyl)-1,3-thiazole-2-carbaldehyde (PubChem CID 84651507) has the molecular formula C5H3F2NOS and a molecular weight of 163.15 g/mol. Its IUPAC name is 5-(difluoromethyl)-1,3-thiazole-2-carbaldehyde.
| Compound Name | 5-(difluoromethyl)-1,3-thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 84651507 |
| Molecular Formula | C5H3F2NOS |
| Molecular Weight | 163.15 g/mol |
| Exact Mass | 162.99 |
| IUPAC Name | 5-(difluoromethyl)-1,3-thiazole-2-carbaldehyde |
| SMILES | O=Cc1ncc(C(F)F)s1 |
| InChI | InChI=1S/C5H3F2NOS/c6-5(7)3-1-8-4(2-9)10-3/h1-2,5H |
| InChIKey | OYZOTEDPXXTMBD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.15 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|