About 2-(2H-pyrazolo[4,3-c]pyridin-3-yl)ethanol
2-(2H-pyrazolo[4,3-c]pyridin-3-yl)ethanol (PubChem CID 84651545) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 2-(2H-pyrazolo[4,3-c]pyridin-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2H-pyrazolo[4,3-c]pyridin-3-yl)ethanol |
| PubChem CID | 84651545 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 2-(2H-pyrazolo[4,3-c]pyridin-3-yl)ethanol |
| SMILES | OCCc1[nH]nc2ccncc12 |
| InChI | InChI=1S/C8H9N3O/c12-4-2-8-6-5-9-3-1-7(6)10-11-8/h1,3,5,12H,2,4H2,(H,10,11) |
| InChIKey | WRTCRPVJDYIPHF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2H-pyrazolo[4,3-c]pyridin-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2H-pyrazolo[4,3-c]pyridin-3-yl)ethanol?
The IUPAC name of 2-(2H-pyrazolo[4,3-c]pyridin-3-yl)ethanol (CID 84651545) is 2-(2H-pyrazolo[4,3-c]pyridin-3-yl)ethanol.
What is the SMILES notation for 2-(2H-pyrazolo[4,3-c]pyridin-3-yl)ethanol?
The canonical SMILES for 2-(2H-pyrazolo[4,3-c]pyridin-3-yl)ethanol is OCCc1[nH]nc2ccncc12.
What is the InChIKey of 2-(2H-pyrazolo[4,3-c]pyridin-3-yl)ethanol?
The InChIKey is WRTCRPVJDYIPHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c12-4-2-8-6-5-9-3-1-7(6)10-11-8/h1,3,5,12H,2,4H2,(H,10,11).
What are the key properties of 2-(2H-pyrazolo[4,3-c]pyridin-3-yl)ethanol?
2-(2H-pyrazolo[4,3-c]pyridin-3-yl)ethanol has a molecular weight of 163.18 g/mol, XLogP of 0.49, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2H-pyrazolo[4,3-c]pyridin-3-yl)ethanol is sourced from PubChem (CID 84651545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).