About [5-(difluoromethyl)-1,3-thiazol-2-yl]methanol
[5-(difluoromethyl)-1,3-thiazol-2-yl]methanol (PubChem CID 84652029) has the molecular formula C5H5F2NOS
and a molecular weight of 165.16 g/mol. Its IUPAC name is [5-(difluoromethyl)-1,3-thiazol-2-yl]methanol.
Molecular Properties
| Compound Name | [5-(difluoromethyl)-1,3-thiazol-2-yl]methanol |
| PubChem CID | 84652029 |
| Molecular Formula | C5H5F2NOS |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.01 |
| IUPAC Name | [5-(difluoromethyl)-1,3-thiazol-2-yl]methanol |
| SMILES | OCc1ncc(C(F)F)s1 |
| InChI | InChI=1S/C5H5F2NOS/c6-5(7)3-1-8-4(2-9)10-3/h1,5,9H,2H2 |
| InChIKey | MYMIONUWRSGIKZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(difluoromethyl)-1,3-thiazol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(difluoromethyl)-1,3-thiazol-2-yl]methanol?
The IUPAC name of [5-(difluoromethyl)-1,3-thiazol-2-yl]methanol (CID 84652029) is [5-(difluoromethyl)-1,3-thiazol-2-yl]methanol.
What is the SMILES notation for [5-(difluoromethyl)-1,3-thiazol-2-yl]methanol?
The canonical SMILES for [5-(difluoromethyl)-1,3-thiazol-2-yl]methanol is OCc1ncc(C(F)F)s1.
What is the InChIKey of [5-(difluoromethyl)-1,3-thiazol-2-yl]methanol?
The InChIKey is MYMIONUWRSGIKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F2NOS/c6-5(7)3-1-8-4(2-9)10-3/h1,5,9H,2H2.
What are the key properties of [5-(difluoromethyl)-1,3-thiazol-2-yl]methanol?
[5-(difluoromethyl)-1,3-thiazol-2-yl]methanol has a molecular weight of 165.16 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(difluoromethyl)-1,3-thiazol-2-yl]methanol is sourced from PubChem (CID 84652029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).