About 4-(1-fluoroethyl)-2,3-dihydro-1H-isoindole
4-(1-fluoroethyl)-2,3-dihydro-1H-isoindole (PubChem CID 84652151) has the molecular formula C10H12FN
and a molecular weight of 165.21 g/mol. Its IUPAC name is 4-(1-fluoroethyl)-2,3-dihydro-1H-isoindole.
Molecular Properties
| Compound Name | 4-(1-fluoroethyl)-2,3-dihydro-1H-isoindole |
| PubChem CID | 84652151 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 4-(1-fluoroethyl)-2,3-dihydro-1H-isoindole |
| SMILES | CC(F)c1cccc2c1CNC2 |
| InChI | InChI=1S/C10H12FN/c1-7(11)9-4-2-3-8-5-12-6-10(8)9/h2-4,7,12H,5-6H2,1H3 |
| InChIKey | RXSSHSIXHJPCNG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(1-fluoroethyl)-2,3-dihydro-1H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-fluoroethyl)-2,3-dihydro-1H-isoindole?
The IUPAC name of 4-(1-fluoroethyl)-2,3-dihydro-1H-isoindole (CID 84652151) is 4-(1-fluoroethyl)-2,3-dihydro-1H-isoindole.
What is the SMILES notation for 4-(1-fluoroethyl)-2,3-dihydro-1H-isoindole?
The canonical SMILES for 4-(1-fluoroethyl)-2,3-dihydro-1H-isoindole is CC(F)c1cccc2c1CNC2.
What is the InChIKey of 4-(1-fluoroethyl)-2,3-dihydro-1H-isoindole?
The InChIKey is RXSSHSIXHJPCNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FN/c1-7(11)9-4-2-3-8-5-12-6-10(8)9/h2-4,7,12H,5-6H2,1H3.
What are the key properties of 4-(1-fluoroethyl)-2,3-dihydro-1H-isoindole?
4-(1-fluoroethyl)-2,3-dihydro-1H-isoindole has a molecular weight of 165.21 g/mol, XLogP of 2.32, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-fluoroethyl)-2,3-dihydro-1H-isoindole is sourced from PubChem (CID 84652151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).