About 2-(cyclopropylmethyl)-1,2,4-triazole-3-carboxylic acid
2-(cyclopropylmethyl)-1,2,4-triazole-3-carboxylic acid (PubChem CID 84652603) has the molecular formula C7H9N3O2
and a molecular weight of 167.17 g/mol. Its IUPAC name is 2-(cyclopropylmethyl)-1,2,4-triazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-(cyclopropylmethyl)-1,2,4-triazole-3-carboxylic acid |
| PubChem CID | 84652603 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 2-(cyclopropylmethyl)-1,2,4-triazole-3-carboxylic acid |
| SMILES | O=C(O)c1ncnn1CC1CC1 |
| InChI | InChI=1S/C7H9N3O2/c11-7(12)6-8-4-9-10(6)3-5-1-2-5/h4-5H,1-3H2,(H,11,12) |
| InChIKey | YQGHJLUOUXGEFW-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(cyclopropylmethyl)-1,2,4-triazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclopropylmethyl)-1,2,4-triazole-3-carboxylic acid?
The IUPAC name of 2-(cyclopropylmethyl)-1,2,4-triazole-3-carboxylic acid (CID 84652603) is 2-(cyclopropylmethyl)-1,2,4-triazole-3-carboxylic acid.
What is the SMILES notation for 2-(cyclopropylmethyl)-1,2,4-triazole-3-carboxylic acid?
The canonical SMILES for 2-(cyclopropylmethyl)-1,2,4-triazole-3-carboxylic acid is O=C(O)c1ncnn1CC1CC1.
What is the InChIKey of 2-(cyclopropylmethyl)-1,2,4-triazole-3-carboxylic acid?
The InChIKey is YQGHJLUOUXGEFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c11-7(12)6-8-4-9-10(6)3-5-1-2-5/h4-5H,1-3H2,(H,11,12).
What are the key properties of 2-(cyclopropylmethyl)-1,2,4-triazole-3-carboxylic acid?
2-(cyclopropylmethyl)-1,2,4-triazole-3-carboxylic acid has a molecular weight of 167.17 g/mol, XLogP of 0.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclopropylmethyl)-1,2,4-triazole-3-carboxylic acid is sourced from PubChem (CID 84652603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).