About 2-(fluoromethyl)-2,3-dihydro-1H-indol-7-ol
2-(fluoromethyl)-2,3-dihydro-1H-indol-7-ol (PubChem CID 84652620) has the molecular formula C9H10FNO
and a molecular weight of 167.18 g/mol. Its IUPAC name is 2-(fluoromethyl)-2,3-dihydro-1H-indol-7-ol.
Molecular Properties
| Compound Name | 2-(fluoromethyl)-2,3-dihydro-1H-indol-7-ol |
| PubChem CID | 84652620 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 2-(fluoromethyl)-2,3-dihydro-1H-indol-7-ol |
| SMILES | Oc1cccc2c1NC(CF)C2 |
| InChI | InChI=1S/C9H10FNO/c10-5-7-4-6-2-1-3-8(12)9(6)11-7/h1-3,7,11-12H,4-5H2 |
| InChIKey | QKSJBHNVKDYUPK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-(fluoromethyl)-2,3-dihydro-1H-indol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(fluoromethyl)-2,3-dihydro-1H-indol-7-ol?
The IUPAC name of 2-(fluoromethyl)-2,3-dihydro-1H-indol-7-ol (CID 84652620) is 2-(fluoromethyl)-2,3-dihydro-1H-indol-7-ol.
What is the SMILES notation for 2-(fluoromethyl)-2,3-dihydro-1H-indol-7-ol?
The canonical SMILES for 2-(fluoromethyl)-2,3-dihydro-1H-indol-7-ol is Oc1cccc2c1NC(CF)C2.
What is the InChIKey of 2-(fluoromethyl)-2,3-dihydro-1H-indol-7-ol?
The InChIKey is QKSJBHNVKDYUPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO/c10-5-7-4-6-2-1-3-8(12)9(6)11-7/h1-3,7,11-12H,4-5H2.
What are the key properties of 2-(fluoromethyl)-2,3-dihydro-1H-indol-7-ol?
2-(fluoromethyl)-2,3-dihydro-1H-indol-7-ol has a molecular weight of 167.18 g/mol, XLogP of 1.70, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(fluoromethyl)-2,3-dihydro-1H-indol-7-ol is sourced from PubChem (CID 84652620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).