About 3-cyclopropyl-5-oxo-1,2-dihydropyrazole-4-carboxylic acid
3-cyclopropyl-5-oxo-1,2-dihydropyrazole-4-carboxylic acid (PubChem CID 84652926) has the molecular formula C7H8N2O3
and a molecular weight of 168.15 g/mol. Its IUPAC name is 3-cyclopropyl-5-oxo-1,2-dihydropyrazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-cyclopropyl-5-oxo-1,2-dihydropyrazole-4-carboxylic acid |
| PubChem CID | 84652926 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | 3-cyclopropyl-5-oxo-1,2-dihydropyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1c(C2CC2)[nH][nH]c1=O |
| InChI | InChI=1S/C7H8N2O3/c10-6-4(7(11)12)5(8-9-6)3-1-2-3/h3H,1-2H2,(H,11,12)(H2,8,9,10) |
| InChIKey | XIHMTLGQIJWIMR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-cyclopropyl-5-oxo-1,2-dihydropyrazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-5-oxo-1,2-dihydropyrazole-4-carboxylic acid?
The IUPAC name of 3-cyclopropyl-5-oxo-1,2-dihydropyrazole-4-carboxylic acid (CID 84652926) is 3-cyclopropyl-5-oxo-1,2-dihydropyrazole-4-carboxylic acid.
What is the SMILES notation for 3-cyclopropyl-5-oxo-1,2-dihydropyrazole-4-carboxylic acid?
The canonical SMILES for 3-cyclopropyl-5-oxo-1,2-dihydropyrazole-4-carboxylic acid is O=C(O)c1c(C2CC2)[nH][nH]c1=O.
What is the InChIKey of 3-cyclopropyl-5-oxo-1,2-dihydropyrazole-4-carboxylic acid?
The InChIKey is XIHMTLGQIJWIMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c10-6-4(7(11)12)5(8-9-6)3-1-2-3/h3H,1-2H2,(H,11,12)(H2,8,9,10).
What are the key properties of 3-cyclopropyl-5-oxo-1,2-dihydropyrazole-4-carboxylic acid?
3-cyclopropyl-5-oxo-1,2-dihydropyrazole-4-carboxylic acid has a molecular weight of 168.15 g/mol, XLogP of 0.28, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-5-oxo-1,2-dihydropyrazole-4-carboxylic acid is sourced from PubChem (CID 84652926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).