About 7-fluoro-5-hydroxy-3H-1,3-benzoxazol-2-one
7-fluoro-5-hydroxy-3H-1,3-benzoxazol-2-one (PubChem CID 84653291) has the molecular formula C7H4FNO3
and a molecular weight of 169.11 g/mol. Its IUPAC name is 7-fluoro-5-hydroxy-3H-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 7-fluoro-5-hydroxy-3H-1,3-benzoxazol-2-one |
| PubChem CID | 84653291 |
| Molecular Formula | C7H4FNO3 |
| Molecular Weight | 169.11 g/mol |
| Exact Mass | 169.02 |
| IUPAC Name | 7-fluoro-5-hydroxy-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(O)cc(F)c2o1 |
| InChI | InChI=1S/C7H4FNO3/c8-4-1-3(10)2-5-6(4)12-7(11)9-5/h1-2,10H,(H,9,11) |
| InChIKey | ISJYTWIQSPNSDZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.11 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluoro-5-hydroxy-3H-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-5-hydroxy-3H-1,3-benzoxazol-2-one?
The IUPAC name of 7-fluoro-5-hydroxy-3H-1,3-benzoxazol-2-one (CID 84653291) is 7-fluoro-5-hydroxy-3H-1,3-benzoxazol-2-one.
What is the SMILES notation for 7-fluoro-5-hydroxy-3H-1,3-benzoxazol-2-one?
The canonical SMILES for 7-fluoro-5-hydroxy-3H-1,3-benzoxazol-2-one is O=c1[nH]c2cc(O)cc(F)c2o1.
What is the InChIKey of 7-fluoro-5-hydroxy-3H-1,3-benzoxazol-2-one?
The InChIKey is ISJYTWIQSPNSDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FNO3/c8-4-1-3(10)2-5-6(4)12-7(11)9-5/h1-2,10H,(H,9,11).
What are the key properties of 7-fluoro-5-hydroxy-3H-1,3-benzoxazol-2-one?
7-fluoro-5-hydroxy-3H-1,3-benzoxazol-2-one has a molecular weight of 169.11 g/mol, XLogP of 0.97, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-5-hydroxy-3H-1,3-benzoxazol-2-one is sourced from PubChem (CID 84653291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).