2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid

C8H11NO3 — CID 84653361

IUPAC2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid
SMILESO=C(O)CC1=NCC(C2CC2)O1
InChIInChI=1S/C8H11NO3/c10-8(11)3-7-9-4-6(12-7)5-1-2-5/h5-6H,1-4H2,(H,10,11)
InChIKeyJGLUNIMHNLFVIF-UHFFFAOYSA-N
MW169.18 g/mol
LogP0.67
Rot. Bonds3

About 2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid

2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid (PubChem CID 84653361) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid.

Molecular Properties

Compound Name2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid
PubChem CID84653361
Molecular FormulaC8H11NO3
Molecular Weight169.18 g/mol
Exact Mass169.07
IUPAC Name2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid
SMILESO=C(O)CC1=NCC(C2CC2)O1
InChIInChI=1S/C8H11NO3/c10-8(11)3-7-9-4-6(12-7)5-1-2-5/h5-6H,1-4H2,(H,10,11)
InChIKeyJGLUNIMHNLFVIF-UHFFFAOYSA-N
XLogP0.67
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.18
LogP ≤ 50.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid?
The IUPAC name of 2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid (CID 84653361) is 2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid.
What is the SMILES notation for 2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid?
The canonical SMILES for 2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid is O=C(O)CC1=NCC(C2CC2)O1.
What is the InChIKey of 2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid?
The InChIKey is JGLUNIMHNLFVIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c10-8(11)3-7-9-4-6(12-7)5-1-2-5/h5-6H,1-4H2,(H,10,11).
What are the key properties of 2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid?
2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid has a molecular weight of 169.18 g/mol, XLogP of 0.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyclopropyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid is sourced from PubChem (CID 84653361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).