About 4,5-dihydrobenzo[e][1,2]benzoxazole
4,5-dihydrobenzo[e][1,2]benzoxazole (PubChem CID 84654087) has the molecular formula C11H9NO
and a molecular weight of 171.20 g/mol. Its IUPAC name is 4,5-dihydrobenzo[e][1,2]benzoxazole.
Molecular Properties
| Compound Name | 4,5-dihydrobenzo[e][1,2]benzoxazole |
| PubChem CID | 84654087 |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | 4,5-dihydrobenzo[e][1,2]benzoxazole |
| SMILES | c1ccc2c(c1)CCc1oncc1-2 |
| InChI | InChI=1S/C11H9NO/c1-2-4-9-8(3-1)5-6-11-10(9)7-12-13-11/h1-4,7H,5-6H2 |
| InChIKey | IPQIZAOOCDWJHC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-dihydrobenzo[e][1,2]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydrobenzo[e][1,2]benzoxazole?
The IUPAC name of 4,5-dihydrobenzo[e][1,2]benzoxazole (CID 84654087) is 4,5-dihydrobenzo[e][1,2]benzoxazole.
What is the SMILES notation for 4,5-dihydrobenzo[e][1,2]benzoxazole?
The canonical SMILES for 4,5-dihydrobenzo[e][1,2]benzoxazole is c1ccc2c(c1)CCc1oncc1-2.
What is the InChIKey of 4,5-dihydrobenzo[e][1,2]benzoxazole?
The InChIKey is IPQIZAOOCDWJHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO/c1-2-4-9-8(3-1)5-6-11-10(9)7-12-13-11/h1-4,7H,5-6H2.
What are the key properties of 4,5-dihydrobenzo[e][1,2]benzoxazole?
4,5-dihydrobenzo[e][1,2]benzoxazole has a molecular weight of 171.20 g/mol, XLogP of 2.44, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydrobenzo[e][1,2]benzoxazole is sourced from PubChem (CID 84654087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).