C11H11NO — CID 84654648
6,7,8,9-tetrahydrofuro[2,3-f]isoquinoline (PubChem CID 84654648) has the molecular formula C11H11NO and a molecular weight of 173.22 g/mol. Its IUPAC name is 6,7,8,9-tetrahydrofuro[2,3-f]isoquinoline.
| Compound Name | 6,7,8,9-tetrahydrofuro[2,3-f]isoquinoline |
|---|---|
| PubChem CID | 84654648 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 6,7,8,9-tetrahydrofuro[2,3-f]isoquinoline |
| SMILES | c1cc2ccc3c(c2o1)CCNC3 |
| InChI | InChI=1S/C11H11NO/c1-2-9-7-12-5-3-10(9)11-8(1)4-6-13-11/h1-2,4,6,12H,3,5,7H2 |
| InChIKey | YALIOGMEAQCPTI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |