About 2-amino-1-(2-chloro-1,3-oxazol-5-yl)propan-1-one
2-amino-1-(2-chloro-1,3-oxazol-5-yl)propan-1-one (PubChem CID 84655052) has the molecular formula C6H7ClN2O2
and a molecular weight of 174.59 g/mol. Its IUPAC name is 2-amino-1-(2-chloro-1,3-oxazol-5-yl)propan-1-one.
Molecular Properties
| Compound Name | 2-amino-1-(2-chloro-1,3-oxazol-5-yl)propan-1-one |
| PubChem CID | 84655052 |
| Molecular Formula | C6H7ClN2O2 |
| Molecular Weight | 174.59 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | 2-amino-1-(2-chloro-1,3-oxazol-5-yl)propan-1-one |
| SMILES | CC(N)C(=O)c1cnc(Cl)o1 |
| InChI | InChI=1S/C6H7ClN2O2/c1-3(8)5(10)4-2-9-6(7)11-4/h2-3H,8H2,1H3 |
| InChIKey | XINXQUZITQJGMN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.59 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-(2-chloro-1,3-oxazol-5-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(2-chloro-1,3-oxazol-5-yl)propan-1-one?
The IUPAC name of 2-amino-1-(2-chloro-1,3-oxazol-5-yl)propan-1-one (CID 84655052) is 2-amino-1-(2-chloro-1,3-oxazol-5-yl)propan-1-one.
What is the SMILES notation for 2-amino-1-(2-chloro-1,3-oxazol-5-yl)propan-1-one?
The canonical SMILES for 2-amino-1-(2-chloro-1,3-oxazol-5-yl)propan-1-one is CC(N)C(=O)c1cnc(Cl)o1.
What is the InChIKey of 2-amino-1-(2-chloro-1,3-oxazol-5-yl)propan-1-one?
The InChIKey is XINXQUZITQJGMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2O2/c1-3(8)5(10)4-2-9-6(7)11-4/h2-3H,8H2,1H3.
What are the key properties of 2-amino-1-(2-chloro-1,3-oxazol-5-yl)propan-1-one?
2-amino-1-(2-chloro-1,3-oxazol-5-yl)propan-1-one has a molecular weight of 174.59 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(2-chloro-1,3-oxazol-5-yl)propan-1-one is sourced from PubChem (CID 84655052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).