About 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine
3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 84655220) has the molecular formula C8H9N5
and a molecular weight of 175.19 g/mol. Its IUPAC name is 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
Analyze 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine?
The IUPAC name of 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (CID 84655220) is 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
What is the SMILES notation for 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine?
The canonical SMILES for 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine is Nc1nccn2c(C3CC3)nnc12.
What is the InChIKey of 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine?
The InChIKey is SMVBUHGIHOGOGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5/c9-6-8-12-11-7(5-1-2-5)13(8)4-3-10-6/h3-5H,1-2H2,(H2,9,10).
What are the key properties of 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine?
3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine has a molecular weight of 175.19 g/mol, XLogP of 0.58, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropyl-[1,2,4]triazolo[4,3-a]pyrazin-8-amine is sourced from PubChem (CID 84655220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).