About 2-amino-7-methyl-7,8-dihydro-6H-quinolin-5-one
2-amino-7-methyl-7,8-dihydro-6H-quinolin-5-one (PubChem CID 84655577) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is 2-amino-7-methyl-7,8-dihydro-6H-quinolin-5-one.
Molecular Properties
| Compound Name | 2-amino-7-methyl-7,8-dihydro-6H-quinolin-5-one |
| PubChem CID | 84655577 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 2-amino-7-methyl-7,8-dihydro-6H-quinolin-5-one |
| SMILES | CC1CC(=O)c2ccc(N)nc2C1 |
| InChI | InChI=1S/C10H12N2O/c1-6-4-8-7(9(13)5-6)2-3-10(11)12-8/h2-3,6H,4-5H2,1H3,(H2,11,12) |
| InChIKey | YQLIAEORMHCZJW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-7-methyl-7,8-dihydro-6H-quinolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7-methyl-7,8-dihydro-6H-quinolin-5-one?
The IUPAC name of 2-amino-7-methyl-7,8-dihydro-6H-quinolin-5-one (CID 84655577) is 2-amino-7-methyl-7,8-dihydro-6H-quinolin-5-one.
What is the SMILES notation for 2-amino-7-methyl-7,8-dihydro-6H-quinolin-5-one?
The canonical SMILES for 2-amino-7-methyl-7,8-dihydro-6H-quinolin-5-one is CC1CC(=O)c2ccc(N)nc2C1.
What is the InChIKey of 2-amino-7-methyl-7,8-dihydro-6H-quinolin-5-one?
The InChIKey is YQLIAEORMHCZJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-6-4-8-7(9(13)5-6)2-3-10(11)12-8/h2-3,6H,4-5H2,1H3,(H2,11,12).
What are the key properties of 2-amino-7-methyl-7,8-dihydro-6H-quinolin-5-one?
2-amino-7-methyl-7,8-dihydro-6H-quinolin-5-one has a molecular weight of 176.22 g/mol, XLogP of 1.43, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7-methyl-7,8-dihydro-6H-quinolin-5-one is sourced from PubChem (CID 84655577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).