About 2-(azetidin-3-yl)-N,N-dimethylaniline
2-(azetidin-3-yl)-N,N-dimethylaniline (PubChem CID 84655728) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-(azetidin-3-yl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 2-(azetidin-3-yl)-N,N-dimethylaniline |
| PubChem CID | 84655728 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-(azetidin-3-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccccc1C1CNC1 |
| InChI | InChI=1S/C11H16N2/c1-13(2)11-6-4-3-5-10(11)9-7-12-8-9/h3-6,9,12H,7-8H2,1-2H3 |
| InChIKey | DSTGQLCPCAABON-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(azetidin-3-yl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azetidin-3-yl)-N,N-dimethylaniline?
The IUPAC name of 2-(azetidin-3-yl)-N,N-dimethylaniline (CID 84655728) is 2-(azetidin-3-yl)-N,N-dimethylaniline.
What is the SMILES notation for 2-(azetidin-3-yl)-N,N-dimethylaniline?
The canonical SMILES for 2-(azetidin-3-yl)-N,N-dimethylaniline is CN(C)c1ccccc1C1CNC1.
What is the InChIKey of 2-(azetidin-3-yl)-N,N-dimethylaniline?
The InChIKey is DSTGQLCPCAABON-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-13(2)11-6-4-3-5-10(11)9-7-12-8-9/h3-6,9,12H,7-8H2,1-2H3.
What are the key properties of 2-(azetidin-3-yl)-N,N-dimethylaniline?
2-(azetidin-3-yl)-N,N-dimethylaniline has a molecular weight of 176.26 g/mol, XLogP of 1.44, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azetidin-3-yl)-N,N-dimethylaniline is sourced from PubChem (CID 84655728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).