5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid

C9H9NO3 — CID 84656779

IUPAC5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid
SMILESO=C(O)c1cc2c(cc1O)CCN2
InChIInChI=1S/C9H9NO3/c11-8-3-5-1-2-10-7(5)4-6(8)9(12)13/h3-4,10-11H,1-2H2,(H,12,13)
InChIKeyYJLPFWDKFLCOKL-UHFFFAOYSA-N
MW179.18 g/mol
LogP1.06
Rot. Bonds1

About 5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid

5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid (PubChem CID 84656779) has the molecular formula C9H9NO3 and a molecular weight of 179.18 g/mol. Its IUPAC name is 5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid.

Molecular Properties

Compound Name5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid
PubChem CID84656779
Molecular FormulaC9H9NO3
Molecular Weight179.18 g/mol
Exact Mass179.06
IUPAC Name5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid
SMILESO=C(O)c1cc2c(cc1O)CCN2
InChIInChI=1S/C9H9NO3/c11-8-3-5-1-2-10-7(5)4-6(8)9(12)13/h3-4,10-11H,1-2H2,(H,12,13)
InChIKeyYJLPFWDKFLCOKL-UHFFFAOYSA-N
XLogP1.06
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.18
LogP ≤ 51.06
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydroquinone', 'substructure': 'N/A'}

Analyze 5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid?
The IUPAC name of 5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid (CID 84656779) is 5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid.
What is the SMILES notation for 5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid?
The canonical SMILES for 5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid is O=C(O)c1cc2c(cc1O)CCN2.
What is the InChIKey of 5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid?
The InChIKey is YJLPFWDKFLCOKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c11-8-3-5-1-2-10-7(5)4-6(8)9(12)13/h3-4,10-11H,1-2H2,(H,12,13).
What are the key properties of 5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid?
5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid has a molecular weight of 179.18 g/mol, XLogP of 1.06, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2,3-dihydro-1H-indole-6-carboxylic acid is sourced from PubChem (CID 84656779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).