About 3,5-dimethyl-[1,2]thiazolo[4,5-d]pyrimidin-7-amine
3,5-dimethyl-[1,2]thiazolo[4,5-d]pyrimidin-7-amine (PubChem CID 84657455) has the molecular formula C7H8N4S
and a molecular weight of 180.24 g/mol. Its IUPAC name is 3,5-dimethyl-[1,2]thiazolo[4,5-d]pyrimidin-7-amine.
Analyze 3,5-dimethyl-[1,2]thiazolo[4,5-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-[1,2]thiazolo[4,5-d]pyrimidin-7-amine?
The IUPAC name of 3,5-dimethyl-[1,2]thiazolo[4,5-d]pyrimidin-7-amine (CID 84657455) is 3,5-dimethyl-[1,2]thiazolo[4,5-d]pyrimidin-7-amine.
What is the SMILES notation for 3,5-dimethyl-[1,2]thiazolo[4,5-d]pyrimidin-7-amine?
The canonical SMILES for 3,5-dimethyl-[1,2]thiazolo[4,5-d]pyrimidin-7-amine is Cc1nc(N)c2snc(C)c2n1.
What is the InChIKey of 3,5-dimethyl-[1,2]thiazolo[4,5-d]pyrimidin-7-amine?
The InChIKey is FEHJUPDNHPTTNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4S/c1-3-5-6(12-11-3)7(8)10-4(2)9-5/h1-2H3,(H2,8,9,10).
What are the key properties of 3,5-dimethyl-[1,2]thiazolo[4,5-d]pyrimidin-7-amine?
3,5-dimethyl-[1,2]thiazolo[4,5-d]pyrimidin-7-amine has a molecular weight of 180.24 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-[1,2]thiazolo[4,5-d]pyrimidin-7-amine is sourced from PubChem (CID 84657455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).