C11H20N2 — CID 84657646
2-[2-(2,5-dihydropyrrol-1-yl)ethyl]piperidine (PubChem CID 84657646) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is 2-[2-(2,5-dihydropyrrol-1-yl)ethyl]piperidine.
| Compound Name | 2-[2-(2,5-dihydropyrrol-1-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 84657646 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 2-[2-(2,5-dihydropyrrol-1-yl)ethyl]piperidine |
| SMILES | C1=CCN(CCC2CCCCN2)C1 |
| InChI | InChI=1S/C11H20N2/c1-2-7-12-11(5-1)6-10-13-8-3-4-9-13/h3-4,11-12H,1-2,5-10H2 |
| InChIKey | ROOXQALDXNXFAA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|