About N-benzyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide
N-benzyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide (PubChem CID 846578) has the molecular formula C13H15N5OS
and a molecular weight of 289.36 g/mol. Its IUPAC name is N-benzyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide.
Molecular Properties
| Compound Name | N-benzyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide |
| PubChem CID | 846578 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-benzyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide |
| SMILES | Nc1cc(N)nc(SCC(=O)NCc2ccccc2)n1 |
| InChI | InChI=1S/C13H15N5OS/c14-10-6-11(15)18-13(17-10)20-8-12(19)16-7-9-4-2-1-3-5-9/h1-6H,7-8H2,(H,16,19)(H4,14,15,17,18) |
| InChIKey | VVFNLMRYMHBQCR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-benzyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide?
The IUPAC name of N-benzyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide (CID 846578) is N-benzyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide.
What is the SMILES notation for N-benzyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide?
The canonical SMILES for N-benzyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide is Nc1cc(N)nc(SCC(=O)NCc2ccccc2)n1.
What is the InChIKey of N-benzyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide?
The InChIKey is VVFNLMRYMHBQCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N5OS/c14-10-6-11(15)18-13(17-10)20-8-12(19)16-7-9-4-2-1-3-5-9/h1-6H,7-8H2,(H,16,19)(H4,14,15,17,18).
What are the key properties of N-benzyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide?
N-benzyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide has a molecular weight of 289.36 g/mol, XLogP of 1.05, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide is sourced from PubChem (CID 846578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).