C10H12FNO — CID 84657900
8-fluoro-7-methoxy-1,2,3,4-tetrahydroisoquinoline (PubChem CID 84657900) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is 8-fluoro-7-methoxy-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 8-fluoro-7-methoxy-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 84657900 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 8-fluoro-7-methoxy-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1ccc2c(c1F)CNCC2 |
| InChI | InChI=1S/C10H12FNO/c1-13-9-3-2-7-4-5-12-6-8(7)10(9)11/h2-3,12H,4-6H2,1H3 |
| InChIKey | VSKNJUBUVUWBJY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |