C8H10N2O3 — CID 84658320
2-(5-methyl-6-oxo-1H-pyrimidin-2-yl)propanoic acid (PubChem CID 84658320) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 2-(5-methyl-6-oxo-1H-pyrimidin-2-yl)propanoic acid.
| Compound Name | 2-(5-methyl-6-oxo-1H-pyrimidin-2-yl)propanoic acid |
|---|---|
| PubChem CID | 84658320 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2-(5-methyl-6-oxo-1H-pyrimidin-2-yl)propanoic acid |
| SMILES | Cc1cnc(C(C)C(=O)O)[nH]c1=O |
| InChI | InChI=1S/C8H10N2O3/c1-4-3-9-6(10-7(4)11)5(2)8(12)13/h3,5H,1-2H3,(H,12,13)(H,9,10,11) |
| InChIKey | FOOSTVQPBSDXPH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |