C9H11ClN2 — CID 84658817
8-chloro-1,2,3,4-tetrahydroquinolin-7-amine (PubChem CID 84658817) has the molecular formula C9H11ClN2 and a molecular weight of 182.65 g/mol. Its IUPAC name is 8-chloro-1,2,3,4-tetrahydroquinolin-7-amine.
| Compound Name | 8-chloro-1,2,3,4-tetrahydroquinolin-7-amine |
|---|---|
| PubChem CID | 84658817 |
| Molecular Formula | C9H11ClN2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 8-chloro-1,2,3,4-tetrahydroquinolin-7-amine |
| SMILES | Nc1ccc2c(c1Cl)NCCC2 |
| InChI | InChI=1S/C9H11ClN2/c10-8-7(11)4-3-6-2-1-5-12-9(6)8/h3-4,12H,1-2,5,11H2 |
| InChIKey | ZFKVXJCABQKVAY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|