About 7-chloro-1,2,3,4-tetrahydroisoquinolin-6-ol
7-chloro-1,2,3,4-tetrahydroisoquinolin-6-ol (PubChem CID 84659348) has the molecular formula C9H10ClNO
and a molecular weight of 183.64 g/mol. Its IUPAC name is 7-chloro-1,2,3,4-tetrahydroisoquinolin-6-ol.
Molecular Properties
| Compound Name | 7-chloro-1,2,3,4-tetrahydroisoquinolin-6-ol |
| PubChem CID | 84659348 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 7-chloro-1,2,3,4-tetrahydroisoquinolin-6-ol |
| SMILES | Oc1cc2c(cc1Cl)CNCC2 |
| InChI | InChI=1S/C9H10ClNO/c10-8-3-7-5-11-2-1-6(7)4-9(8)12/h3-4,11-12H,1-2,5H2 |
| InChIKey | QGYZETOVFDSNSQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-1,2,3,4-tetrahydroisoquinolin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1,2,3,4-tetrahydroisoquinolin-6-ol?
The IUPAC name of 7-chloro-1,2,3,4-tetrahydroisoquinolin-6-ol (CID 84659348) is 7-chloro-1,2,3,4-tetrahydroisoquinolin-6-ol.
What is the SMILES notation for 7-chloro-1,2,3,4-tetrahydroisoquinolin-6-ol?
The canonical SMILES for 7-chloro-1,2,3,4-tetrahydroisoquinolin-6-ol is Oc1cc2c(cc1Cl)CNCC2.
What is the InChIKey of 7-chloro-1,2,3,4-tetrahydroisoquinolin-6-ol?
The InChIKey is QGYZETOVFDSNSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO/c10-8-3-7-5-11-2-1-6(7)4-9(8)12/h3-4,11-12H,1-2,5H2.
What are the key properties of 7-chloro-1,2,3,4-tetrahydroisoquinolin-6-ol?
7-chloro-1,2,3,4-tetrahydroisoquinolin-6-ol has a molecular weight of 183.64 g/mol, XLogP of 1.69, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1,2,3,4-tetrahydroisoquinolin-6-ol is sourced from PubChem (CID 84659348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).