About 6-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol
6-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol (PubChem CID 84659358) has the molecular formula C9H10ClNO
and a molecular weight of 183.64 g/mol. Its IUPAC name is 6-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol.
Molecular Properties
| Compound Name | 6-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol |
| PubChem CID | 84659358 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 6-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol |
| SMILES | Oc1cc(Cl)cc2c1CNCC2 |
| InChI | InChI=1S/C9H10ClNO/c10-7-3-6-1-2-11-5-8(6)9(12)4-7/h3-4,11-12H,1-2,5H2 |
| InChIKey | YZKWFAGBQLVRPG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol?
The IUPAC name of 6-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol (CID 84659358) is 6-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol.
What is the SMILES notation for 6-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol?
The canonical SMILES for 6-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol is Oc1cc(Cl)cc2c1CNCC2.
What is the InChIKey of 6-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol?
The InChIKey is YZKWFAGBQLVRPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO/c10-7-3-6-1-2-11-5-8(6)9(12)4-7/h3-4,11-12H,1-2,5H2.
What are the key properties of 6-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol?
6-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol has a molecular weight of 183.64 g/mol, XLogP of 1.69, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1,2,3,4-tetrahydroisoquinolin-8-ol is sourced from PubChem (CID 84659358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).