About 4-fluoro-4-(1,2,4-triazol-1-ylmethyl)piperidine
4-fluoro-4-(1,2,4-triazol-1-ylmethyl)piperidine (PubChem CID 84659622) has the molecular formula C8H13FN4
and a molecular weight of 184.22 g/mol. Its IUPAC name is 4-fluoro-4-(1,2,4-triazol-1-ylmethyl)piperidine.
Molecular Properties
| Compound Name | 4-fluoro-4-(1,2,4-triazol-1-ylmethyl)piperidine |
| PubChem CID | 84659622 |
| Molecular Formula | C8H13FN4 |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 4-fluoro-4-(1,2,4-triazol-1-ylmethyl)piperidine |
| SMILES | FC1(Cn2cncn2)CCNCC1 |
| InChI | InChI=1S/C8H13FN4/c9-8(1-3-10-4-2-8)5-13-7-11-6-12-13/h6-7,10H,1-5H2 |
| InChIKey | QGCNEODQCCDUKF-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-fluoro-4-(1,2,4-triazol-1-ylmethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-4-(1,2,4-triazol-1-ylmethyl)piperidine?
The IUPAC name of 4-fluoro-4-(1,2,4-triazol-1-ylmethyl)piperidine (CID 84659622) is 4-fluoro-4-(1,2,4-triazol-1-ylmethyl)piperidine.
What is the SMILES notation for 4-fluoro-4-(1,2,4-triazol-1-ylmethyl)piperidine?
The canonical SMILES for 4-fluoro-4-(1,2,4-triazol-1-ylmethyl)piperidine is FC1(Cn2cncn2)CCNCC1.
What is the InChIKey of 4-fluoro-4-(1,2,4-triazol-1-ylmethyl)piperidine?
The InChIKey is QGCNEODQCCDUKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13FN4/c9-8(1-3-10-4-2-8)5-13-7-11-6-12-13/h6-7,10H,1-5H2.
What are the key properties of 4-fluoro-4-(1,2,4-triazol-1-ylmethyl)piperidine?
4-fluoro-4-(1,2,4-triazol-1-ylmethyl)piperidine has a molecular weight of 184.22 g/mol, XLogP of 0.37, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-4-(1,2,4-triazol-1-ylmethyl)piperidine is sourced from PubChem (CID 84659622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).