About 2-(difluoromethyl)-2,3-dihydro-1H-indol-7-ol
2-(difluoromethyl)-2,3-dihydro-1H-indol-7-ol (PubChem CID 84659926) has the molecular formula C9H9F2NO
and a molecular weight of 185.17 g/mol. Its IUPAC name is 2-(difluoromethyl)-2,3-dihydro-1H-indol-7-ol.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-2,3-dihydro-1H-indol-7-ol |
| PubChem CID | 84659926 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 2-(difluoromethyl)-2,3-dihydro-1H-indol-7-ol |
| SMILES | Oc1cccc2c1NC(C(F)F)C2 |
| InChI | InChI=1S/C9H9F2NO/c10-9(11)6-4-5-2-1-3-7(13)8(5)12-6/h1-3,6,9,12-13H,4H2 |
| InChIKey | OUKXHNXMMFYXCM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-(difluoromethyl)-2,3-dihydro-1H-indol-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-2,3-dihydro-1H-indol-7-ol?
The IUPAC name of 2-(difluoromethyl)-2,3-dihydro-1H-indol-7-ol (CID 84659926) is 2-(difluoromethyl)-2,3-dihydro-1H-indol-7-ol.
What is the SMILES notation for 2-(difluoromethyl)-2,3-dihydro-1H-indol-7-ol?
The canonical SMILES for 2-(difluoromethyl)-2,3-dihydro-1H-indol-7-ol is Oc1cccc2c1NC(C(F)F)C2.
What is the InChIKey of 2-(difluoromethyl)-2,3-dihydro-1H-indol-7-ol?
The InChIKey is OUKXHNXMMFYXCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO/c10-9(11)6-4-5-2-1-3-7(13)8(5)12-6/h1-3,6,9,12-13H,4H2.
What are the key properties of 2-(difluoromethyl)-2,3-dihydro-1H-indol-7-ol?
2-(difluoromethyl)-2,3-dihydro-1H-indol-7-ol has a molecular weight of 185.17 g/mol, XLogP of 1.99, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-2,3-dihydro-1H-indol-7-ol is sourced from PubChem (CID 84659926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).