About 4,4-difluoro-2,3-dihydrochromen-8-amine
4,4-difluoro-2,3-dihydrochromen-8-amine (PubChem CID 84659928) has the molecular formula C9H9F2NO
and a molecular weight of 185.17 g/mol. Its IUPAC name is 4,4-difluoro-2,3-dihydrochromen-8-amine.
Molecular Properties
| Compound Name | 4,4-difluoro-2,3-dihydrochromen-8-amine |
| PubChem CID | 84659928 |
| Molecular Formula | C9H9F2NO |
| Molecular Weight | 185.17 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 4,4-difluoro-2,3-dihydrochromen-8-amine |
| SMILES | Nc1cccc2c1OCCC2(F)F |
| InChI | InChI=1S/C9H9F2NO/c10-9(11)4-5-13-8-6(9)2-1-3-7(8)12/h1-3H,4-5,12H2 |
| InChIKey | OCMOJUHDCVZCCR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4,4-difluoro-2,3-dihydrochromen-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-2,3-dihydrochromen-8-amine?
The IUPAC name of 4,4-difluoro-2,3-dihydrochromen-8-amine (CID 84659928) is 4,4-difluoro-2,3-dihydrochromen-8-amine.
What is the SMILES notation for 4,4-difluoro-2,3-dihydrochromen-8-amine?
The canonical SMILES for 4,4-difluoro-2,3-dihydrochromen-8-amine is Nc1cccc2c1OCCC2(F)F.
What is the InChIKey of 4,4-difluoro-2,3-dihydrochromen-8-amine?
The InChIKey is OCMOJUHDCVZCCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F2NO/c10-9(11)4-5-13-8-6(9)2-1-3-7(8)12/h1-3H,4-5,12H2.
What are the key properties of 4,4-difluoro-2,3-dihydrochromen-8-amine?
4,4-difluoro-2,3-dihydrochromen-8-amine has a molecular weight of 185.17 g/mol, XLogP of 2.14, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-2,3-dihydrochromen-8-amine is sourced from PubChem (CID 84659928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).