About 5-(difluoromethyl)-1,3-benzothiazole
5-(difluoromethyl)-1,3-benzothiazole (PubChem CID 84660003) has the molecular formula C8H5F2NS
and a molecular weight of 185.20 g/mol. Its IUPAC name is 5-(difluoromethyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-(difluoromethyl)-1,3-benzothiazole |
| PubChem CID | 84660003 |
| Molecular Formula | C8H5F2NS |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | 5-(difluoromethyl)-1,3-benzothiazole |
| SMILES | FC(F)c1ccc2scnc2c1 |
| InChI | InChI=1S/C8H5F2NS/c9-8(10)5-1-2-7-6(3-5)11-4-12-7/h1-4,8H |
| InChIKey | OGLPCHWFNHQKCB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(difluoromethyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethyl)-1,3-benzothiazole?
The IUPAC name of 5-(difluoromethyl)-1,3-benzothiazole (CID 84660003) is 5-(difluoromethyl)-1,3-benzothiazole.
What is the SMILES notation for 5-(difluoromethyl)-1,3-benzothiazole?
The canonical SMILES for 5-(difluoromethyl)-1,3-benzothiazole is FC(F)c1ccc2scnc2c1.
What is the InChIKey of 5-(difluoromethyl)-1,3-benzothiazole?
The InChIKey is OGLPCHWFNHQKCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F2NS/c9-8(10)5-1-2-7-6(3-5)11-4-12-7/h1-4,8H.
What are the key properties of 5-(difluoromethyl)-1,3-benzothiazole?
5-(difluoromethyl)-1,3-benzothiazole has a molecular weight of 185.20 g/mol, XLogP of 3.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethyl)-1,3-benzothiazole is sourced from PubChem (CID 84660003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).