About 2-(5-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid
2-(5-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid (PubChem CID 84660144) has the molecular formula C9H15NO3
and a molecular weight of 185.22 g/mol. Its IUPAC name is 2-(5-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(5-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid |
| PubChem CID | 84660144 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 2-(5-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid |
| SMILES | CC(C)(C)C1CN=C(CC(=O)O)O1 |
| InChI | InChI=1S/C9H15NO3/c1-9(2,3)6-5-10-7(13-6)4-8(11)12/h6H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | WCEFVLQNSUKCRQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid?
The IUPAC name of 2-(5-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid (CID 84660144) is 2-(5-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid.
What is the SMILES notation for 2-(5-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid?
The canonical SMILES for 2-(5-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid is CC(C)(C)C1CN=C(CC(=O)O)O1.
What is the InChIKey of 2-(5-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid?
The InChIKey is WCEFVLQNSUKCRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3/c1-9(2,3)6-5-10-7(13-6)4-8(11)12/h6H,4-5H2,1-3H3,(H,11,12).
What are the key properties of 2-(5-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid?
2-(5-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid has a molecular weight of 185.22 g/mol, XLogP of 1.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid is sourced from PubChem (CID 84660144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).