2-(3-propylpiperidin-4-yl)acetic acid

C10H19NO2 — CID 84660229

IUPAC2-(3-propylpiperidin-4-yl)acetic acid
SMILESCCCC1CNCCC1CC(=O)O
InChIInChI=1S/C10H19NO2/c1-2-3-9-7-11-5-4-8(9)6-10(12)13/h8-9,11H,2-7H2,1H3,(H,12,13)
InChIKeyWJEORVXUQPEKKU-UHFFFAOYSA-N
MW185.27 g/mol
LogP1.49
Rot. Bonds4

About 2-(3-propylpiperidin-4-yl)acetic acid

2-(3-propylpiperidin-4-yl)acetic acid (PubChem CID 84660229) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-(3-propylpiperidin-4-yl)acetic acid.

Molecular Properties

Compound Name2-(3-propylpiperidin-4-yl)acetic acid
PubChem CID84660229
Molecular FormulaC10H19NO2
Molecular Weight185.27 g/mol
Exact Mass185.14
IUPAC Name2-(3-propylpiperidin-4-yl)acetic acid
SMILESCCCC1CNCCC1CC(=O)O
InChIInChI=1S/C10H19NO2/c1-2-3-9-7-11-5-4-8(9)6-10(12)13/h8-9,11H,2-7H2,1H3,(H,12,13)
InChIKeyWJEORVXUQPEKKU-UHFFFAOYSA-N
XLogP1.49
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.27
LogP ≤ 51.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(3-propylpiperidin-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-propylpiperidin-4-yl)acetic acid?
The IUPAC name of 2-(3-propylpiperidin-4-yl)acetic acid (CID 84660229) is 2-(3-propylpiperidin-4-yl)acetic acid.
What is the SMILES notation for 2-(3-propylpiperidin-4-yl)acetic acid?
The canonical SMILES for 2-(3-propylpiperidin-4-yl)acetic acid is CCCC1CNCCC1CC(=O)O.
What is the InChIKey of 2-(3-propylpiperidin-4-yl)acetic acid?
The InChIKey is WJEORVXUQPEKKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2/c1-2-3-9-7-11-5-4-8(9)6-10(12)13/h8-9,11H,2-7H2,1H3,(H,12,13).
What are the key properties of 2-(3-propylpiperidin-4-yl)acetic acid?
2-(3-propylpiperidin-4-yl)acetic acid has a molecular weight of 185.27 g/mol, XLogP of 1.49, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-propylpiperidin-4-yl)acetic acid is sourced from PubChem (CID 84660229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).