About 4-bromo-1,1-difluoro-3-methylbutane
4-bromo-1,1-difluoro-3-methylbutane (PubChem CID 84660820) has the molecular formula C5H9BrF2
and a molecular weight of 187.03 g/mol. Its IUPAC name is 4-bromo-1,1-difluoro-3-methylbutane.
Molecular Properties
| Compound Name | 4-bromo-1,1-difluoro-3-methylbutane |
| PubChem CID | 84660820 |
| Molecular Formula | C5H9BrF2 |
| Molecular Weight | 187.03 g/mol |
| Exact Mass | 185.99 |
| IUPAC Name | 4-bromo-1,1-difluoro-3-methylbutane |
| SMILES | CC(CBr)CC(F)F |
| InChI | InChI=1S/C5H9BrF2/c1-4(3-6)2-5(7)8/h4-5H,2-3H2,1H3 |
| InChIKey | YTECMPOOTPVUPA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.03 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1,1-difluoro-3-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,1-difluoro-3-methylbutane?
The IUPAC name of 4-bromo-1,1-difluoro-3-methylbutane (CID 84660820) is 4-bromo-1,1-difluoro-3-methylbutane.
What is the SMILES notation for 4-bromo-1,1-difluoro-3-methylbutane?
The canonical SMILES for 4-bromo-1,1-difluoro-3-methylbutane is CC(CBr)CC(F)F.
What is the InChIKey of 4-bromo-1,1-difluoro-3-methylbutane?
The InChIKey is YTECMPOOTPVUPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9BrF2/c1-4(3-6)2-5(7)8/h4-5H,2-3H2,1H3.
What are the key properties of 4-bromo-1,1-difluoro-3-methylbutane?
4-bromo-1,1-difluoro-3-methylbutane has a molecular weight of 187.03 g/mol, XLogP of 2.67, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,1-difluoro-3-methylbutane is sourced from PubChem (CID 84660820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).