About 4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-8-carbonitrile
4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-8-carbonitrile (PubChem CID 84661392) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is 4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-8-carbonitrile.
Molecular Properties
| Compound Name | 4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-8-carbonitrile |
| PubChem CID | 84661392 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-8-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)OCCC(=O)N2 |
| InChI | InChI=1S/C10H8N2O2/c11-6-7-1-2-8-9(5-7)14-4-3-10(13)12-8/h1-2,5H,3-4H2,(H,12,13) |
| InChIKey | LADWTOHHYDXJRV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-8-carbonitrile?
The IUPAC name of 4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-8-carbonitrile (CID 84661392) is 4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-8-carbonitrile.
What is the SMILES notation for 4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-8-carbonitrile?
The canonical SMILES for 4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-8-carbonitrile is N#Cc1ccc2c(c1)OCCC(=O)N2.
What is the InChIKey of 4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-8-carbonitrile?
The InChIKey is LADWTOHHYDXJRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c11-6-7-1-2-8-9(5-7)14-4-3-10(13)12-8/h1-2,5H,3-4H2,(H,12,13).
What are the key properties of 4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-8-carbonitrile?
4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-8-carbonitrile has a molecular weight of 188.19 g/mol, XLogP of 1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3,5-dihydro-2H-1,5-benzoxazepine-8-carbonitrile is sourced from PubChem (CID 84661392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).