C11H12N2O — CID 84661457
4-amino-3,5-dimethyl-2H-isoquinolin-1-one (PubChem CID 84661457) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-amino-3,5-dimethyl-2H-isoquinolin-1-one.
| Compound Name | 4-amino-3,5-dimethyl-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 84661457 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 4-amino-3,5-dimethyl-2H-isoquinolin-1-one |
| SMILES | Cc1[nH]c(=O)c2cccc(C)c2c1N |
| InChI | InChI=1S/C11H12N2O/c1-6-4-3-5-8-9(6)10(12)7(2)13-11(8)14/h3-5H,12H2,1-2H3,(H,13,14) |
| InChIKey | MWIZHQZNWSUSAD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |