About 6-cyclopropyl-1-methylpyrazolo[5,4-b]pyridin-4-amine
6-cyclopropyl-1-methylpyrazolo[5,4-b]pyridin-4-amine (PubChem CID 84661533) has the molecular formula C10H12N4
and a molecular weight of 188.23 g/mol. Its IUPAC name is 6-cyclopropyl-1-methylpyrazolo[5,4-b]pyridin-4-amine.
Molecular Properties
| Compound Name | 6-cyclopropyl-1-methylpyrazolo[5,4-b]pyridin-4-amine |
| PubChem CID | 84661533 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 6-cyclopropyl-1-methylpyrazolo[5,4-b]pyridin-4-amine |
| SMILES | Cn1ncc2c(N)cc(C3CC3)nc21 |
| InChI | InChI=1S/C10H12N4/c1-14-10-7(5-12-14)8(11)4-9(13-10)6-2-3-6/h4-6H,2-3H2,1H3,(H2,11,13) |
| InChIKey | KFFBPDPAJNYQBN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-cyclopropyl-1-methylpyrazolo[5,4-b]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyl-1-methylpyrazolo[5,4-b]pyridin-4-amine?
The IUPAC name of 6-cyclopropyl-1-methylpyrazolo[5,4-b]pyridin-4-amine (CID 84661533) is 6-cyclopropyl-1-methylpyrazolo[5,4-b]pyridin-4-amine.
What is the SMILES notation for 6-cyclopropyl-1-methylpyrazolo[5,4-b]pyridin-4-amine?
The canonical SMILES for 6-cyclopropyl-1-methylpyrazolo[5,4-b]pyridin-4-amine is Cn1ncc2c(N)cc(C3CC3)nc21.
What is the InChIKey of 6-cyclopropyl-1-methylpyrazolo[5,4-b]pyridin-4-amine?
The InChIKey is KFFBPDPAJNYQBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4/c1-14-10-7(5-12-14)8(11)4-9(13-10)6-2-3-6/h4-6H,2-3H2,1H3,(H2,11,13).
What are the key properties of 6-cyclopropyl-1-methylpyrazolo[5,4-b]pyridin-4-amine?
6-cyclopropyl-1-methylpyrazolo[5,4-b]pyridin-4-amine has a molecular weight of 188.23 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyl-1-methylpyrazolo[5,4-b]pyridin-4-amine is sourced from PubChem (CID 84661533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).