About 6-cyclopropyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine
6-cyclopropyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine (PubChem CID 84662225) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 6-cyclopropyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine.
Molecular Properties
| Compound Name | 6-cyclopropyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine |
| PubChem CID | 84662225 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 6-cyclopropyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine |
| SMILES | Nc1cnc2c(c1)CN(C1CC1)CC2 |
| InChI | InChI=1S/C11H15N3/c12-9-5-8-7-14(10-1-2-10)4-3-11(8)13-6-9/h5-6,10H,1-4,7,12H2 |
| InChIKey | XAQQPYZURQIZOF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-cyclopropyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine?
The IUPAC name of 6-cyclopropyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine (CID 84662225) is 6-cyclopropyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine.
What is the SMILES notation for 6-cyclopropyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine?
The canonical SMILES for 6-cyclopropyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine is Nc1cnc2c(c1)CN(C1CC1)CC2.
What is the InChIKey of 6-cyclopropyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine?
The InChIKey is XAQQPYZURQIZOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c12-9-5-8-7-14(10-1-2-10)4-3-11(8)13-6-9/h5-6,10H,1-4,7,12H2.
What are the key properties of 6-cyclopropyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine?
6-cyclopropyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine has a molecular weight of 189.26 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyl-7,8-dihydro-5H-1,6-naphthyridin-3-amine is sourced from PubChem (CID 84662225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).